Carboxylic acid-poly(ethylene glycol)-b-poly(ε-caprolactone)

C₃H₅O₃[C₂H₄O]_n[C₆H₁₀O₂]_mH

Carboxylic acid-poly(ethylene glycol)-b-poly(ε-caprolactone) is a functionalized, amphiphilic, diblock copolymer composed of a hydrophilic PEG block and a hydrophobic PCL block. These biodegradable, biocompatible polymers can self-assemble to form nanoparticles, such as micelles and polymersomes, in both aqueous and non-aqueous media. Due to these properties, these polymers are widely used in polymeric nanoparticle formulation to achieve controlled and targeted delivery of therapeutic agents (e.g. APIs, genetic material, peptides, vaccines, and antibiotics). Additionally, well-defined nanoparticles with tunable size and properties can be prepared by altering the molecular weight ratios between hydrophilic and hydrophobic blocks, as well as by controlling formulation parameters. The carboxylic acid functional group on the PEG chain enables rapid and facile surface functionalization, allowing for these materials to be used in applications such as targeted drug delivery.

100

powder or chunks

PCL average M_n 10,000 (by NMR)
PCL average M_n 10,000
PEG average M_n 5,000 (by NMR)
PEG average M_n 5,000

white to beige

−20℃

[H]OCCCCCC(OCCOCCC(O)=O)=O

11 - Combustible Solids

WGK 3